C8H15NO3S — CID 141478891
azanium 1,5-dimethylcyclohexa-2,4-diene-1-sulfonate (PubChem CID 141478891) has the molecular formula C8H15NO3S and a molecular weight of 205.28 g/mol. Its IUPAC name is azanium 1,5-dimethylcyclohexa-2,4-diene-1-sulfonate.
| Compound Name | azanium 1,5-dimethylcyclohexa-2,4-diene-1-sulfonate |
|---|---|
| PubChem CID | 141478891 |
| Molecular Formula | C8H15NO3S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | azanium 1,5-dimethylcyclohexa-2,4-diene-1-sulfonate |
| SMILES | CC1=CC=CC(C)(S(=O)(=O)[O-])C1.[NH4+] |
| InChI | InChI=1S/C8H12O3S.H3N/c1-7-4-3-5-8(2,6-7)12(9,10)11;/h3-5H,6H2,1-2H3,(H,9,10,11);1H3 |
| InChIKey | HOSUMJMTWCWJJY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|