1,5-dimethylcyclohexa-2,4-diene-1-sulfinic acid

C8H12O2S — CID 163846688

IUPAC1,5-dimethylcyclohexa-2,4-diene-1-sulfinic acid
SMILESCC1=CC=CC(C)(S(=O)O)C1
InChIInChI=1S/C8H12O2S/c1-7-4-3-5-8(2,6-7)11(9)10/h3-5H,6H2,1-2H3,(H,9,10)
InChIKeyOQUSBHLUHXYZOZ-UHFFFAOYSA-N
MW172.25 g/mol
LogP1.87
Rot. Bonds1

About 1,5-dimethylcyclohexa-2,4-diene-1-sulfinic acid

1,5-dimethylcyclohexa-2,4-diene-1-sulfinic acid (PubChem CID 163846688) has the molecular formula C8H12O2S and a molecular weight of 172.25 g/mol. Its IUPAC name is 1,5-dimethylcyclohexa-2,4-diene-1-sulfinic acid.

Molecular Properties

Compound Name1,5-dimethylcyclohexa-2,4-diene-1-sulfinic acid
PubChem CID163846688
Molecular FormulaC8H12O2S
Molecular Weight172.25 g/mol
Exact Mass172.06
IUPAC Name1,5-dimethylcyclohexa-2,4-diene-1-sulfinic acid
SMILESCC1=CC=CC(C)(S(=O)O)C1
InChIInChI=1S/C8H12O2S/c1-7-4-3-5-8(2,6-7)11(9)10/h3-5H,6H2,1-2H3,(H,9,10)
InChIKeyOQUSBHLUHXYZOZ-UHFFFAOYSA-N
XLogP1.87
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.25
LogP ≤ 51.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze 1,5-dimethylcyclohexa-2,4-diene-1-sulfinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,5-dimethylcyclohexa-2,4-diene-1-sulfinic acid?
The IUPAC name of 1,5-dimethylcyclohexa-2,4-diene-1-sulfinic acid (CID 163846688) is 1,5-dimethylcyclohexa-2,4-diene-1-sulfinic acid.
What is the SMILES notation for 1,5-dimethylcyclohexa-2,4-diene-1-sulfinic acid?
The canonical SMILES for 1,5-dimethylcyclohexa-2,4-diene-1-sulfinic acid is CC1=CC=CC(C)(S(=O)O)C1.
What is the InChIKey of 1,5-dimethylcyclohexa-2,4-diene-1-sulfinic acid?
The InChIKey is OQUSBHLUHXYZOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2S/c1-7-4-3-5-8(2,6-7)11(9)10/h3-5H,6H2,1-2H3,(H,9,10).
What are the key properties of 1,5-dimethylcyclohexa-2,4-diene-1-sulfinic acid?
1,5-dimethylcyclohexa-2,4-diene-1-sulfinic acid has a molecular weight of 172.25 g/mol, XLogP of 1.87, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethylcyclohexa-2,4-diene-1-sulfinic acid is sourced from PubChem (CID 163846688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).