C11H18O5S — CID 141237586
1,1-dihydroxypropyl 1,5-dimethylcyclohexa-2,4-diene-1-sulfonate (PubChem CID 141237586) has the molecular formula C11H18O5S and a molecular weight of 262.33 g/mol. Its IUPAC name is 1,1-dihydroxypropyl 1,5-dimethylcyclohexa-2,4-diene-1-sulfonate.
| Compound Name | 1,1-dihydroxypropyl 1,5-dimethylcyclohexa-2,4-diene-1-sulfonate |
|---|---|
| PubChem CID | 141237586 |
| Molecular Formula | C11H18O5S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 1,1-dihydroxypropyl 1,5-dimethylcyclohexa-2,4-diene-1-sulfonate |
| SMILES | CCC(O)(O)OS(=O)(=O)C1(C)C=CC=C(C)C1 |
| InChI | InChI=1S/C11H18O5S/c1-4-11(12,13)16-17(14,15)10(3)7-5-6-9(2)8-10/h5-7,12-13H,4,8H2,1-3H3 |
| InChIKey | XXVJNMXCKJTMHU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|