C11H17Cl — CID 124639676
(5R)-5-[(1R)-1-chloropropyl]-1,5-dimethylcyclohexa-1,3-diene (PubChem CID 124639676) has the molecular formula C11H17Cl and a molecular weight of 184.71 g/mol. Its IUPAC name is (5R)-5-[(1R)-1-chloropropyl]-1,5-dimethylcyclohexa-1,3-diene.
| Compound Name | (5R)-5-[(1R)-1-chloropropyl]-1,5-dimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 124639676 |
| Molecular Formula | C11H17Cl |
| Molecular Weight | 184.71 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | (5R)-5-[(1R)-1-chloropropyl]-1,5-dimethylcyclohexa-1,3-diene |
| SMILES | CC[C@@H](Cl)[C@@]1(C)C=CC=C(C)C1 |
| InChI | InChI=1S/C11H17Cl/c1-4-10(12)11(3)7-5-6-9(2)8-11/h5-7,10H,4,8H2,1-3H3/t10-,11+/m1/s1 |
| InChIKey | XAIGBRZAVKWJTJ-MNOVXSKESA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.71 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|