C11H14F3NO2S — CID 149370449
N-(1,5-dimethylcycloocta-2,4,7-trien-1-yl)-1,1,1-trifluoromethanesulfonamide (PubChem CID 149370449) has the molecular formula C11H14F3NO2S and a molecular weight of 281.30 g/mol. Its IUPAC name is N-(1,5-dimethylcycloocta-2,4,7-trien-1-yl)-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-(1,5-dimethylcycloocta-2,4,7-trien-1-yl)-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 149370449 |
| Molecular Formula | C11H14F3NO2S |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | N-(1,5-dimethylcycloocta-2,4,7-trien-1-yl)-1,1,1-trifluoromethanesulfonamide |
| SMILES | CC1=CC=CC(C)(NS(=O)(=O)C(F)(F)F)C=CC1 |
| InChI | InChI=1S/C11H14F3NO2S/c1-9-5-3-7-10(2,8-4-6-9)15-18(16,17)11(12,13)14/h3-5,7-8,15H,6H2,1-2H3 |
| InChIKey | YJRURIBFZSEJPW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|