C12H20N2O3S — CID 151549279
(5-butyl-5-methylcyclohexa-1,3-dien-1-yl)sulfonylurea (PubChem CID 151549279) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is (5-butyl-5-methylcyclohexa-1,3-dien-1-yl)sulfonylurea.
| Compound Name | (5-butyl-5-methylcyclohexa-1,3-dien-1-yl)sulfonylurea |
|---|---|
| PubChem CID | 151549279 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (5-butyl-5-methylcyclohexa-1,3-dien-1-yl)sulfonylurea |
| SMILES | CCCCC1(C)C=CC=C(S(=O)(=O)NC(N)=O)C1 |
| InChI | InChI=1S/C12H20N2O3S/c1-3-4-7-12(2)8-5-6-10(9-12)18(16,17)14-11(13)15/h5-6,8H,3-4,7,9H2,1-2H3,(H3,13,14,15) |
| InChIKey | QACVPZZOLHWCHD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |