C13H20N2O2 — CID 152768164
1-pentylcyclohexa-3,5-diene-1,3-dicarboxamide (PubChem CID 152768164) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-pentylcyclohexa-3,5-diene-1,3-dicarboxamide.
| Compound Name | 1-pentylcyclohexa-3,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 152768164 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 1-pentylcyclohexa-3,5-diene-1,3-dicarboxamide |
| SMILES | CCCCCC1(C(N)=O)C=CC=C(C(N)=O)C1 |
| InChI | InChI=1S/C13H20N2O2/c1-2-3-4-7-13(12(15)17)8-5-6-10(9-13)11(14)16/h5-6,8H,2-4,7,9H2,1H3,(H2,14,16)(H2,15,17) |
| InChIKey | FXHNLJWIXGPOSO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|