C11H14N2O2 — CID 154390068
1-cyclopropylcyclohexa-3,5-diene-1,3-dicarboxamide (PubChem CID 154390068) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 1-cyclopropylcyclohexa-3,5-diene-1,3-dicarboxamide.
| Compound Name | 1-cyclopropylcyclohexa-3,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 154390068 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-cyclopropylcyclohexa-3,5-diene-1,3-dicarboxamide |
| SMILES | NC(=O)C1=CC=CC(C(N)=O)(C2CC2)C1 |
| InChI | InChI=1S/C11H14N2O2/c12-9(14)7-2-1-5-11(6-7,10(13)15)8-3-4-8/h1-2,5,8H,3-4,6H2,(H2,12,14)(H2,13,15) |
| InChIKey | NAJLNRWDQOHFMU-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |