C11H17NO5 — CID 67946506
5-(2,3-dihydroxypropoxy)-5-methoxycyclohexa-1,3-diene-1-carboxamide (PubChem CID 67946506) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is 5-(2,3-dihydroxypropoxy)-5-methoxycyclohexa-1,3-diene-1-carboxamide.
| Compound Name | 5-(2,3-dihydroxypropoxy)-5-methoxycyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 67946506 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 5-(2,3-dihydroxypropoxy)-5-methoxycyclohexa-1,3-diene-1-carboxamide |
| SMILES | COC1(OCC(O)CO)C=CC=C(C(N)=O)C1 |
| InChI | InChI=1S/C11H17NO5/c1-16-11(17-7-9(14)6-13)4-2-3-8(5-11)10(12)15/h2-4,9,13-14H,5-7H2,1H3,(H2,12,15) |
| InChIKey | ZNAJZSORVYCVPK-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|