About 2,3-dihydroxypropyl 5-methylcyclopenta-1,4-diene-1-carboxylate
2,3-dihydroxypropyl 5-methylcyclopenta-1,4-diene-1-carboxylate (PubChem CID 173342790) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 5-methylcyclopenta-1,4-diene-1-carboxylate.
Analyze 2,3-dihydroxypropyl 5-methylcyclopenta-1,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxypropyl 5-methylcyclopenta-1,4-diene-1-carboxylate?
The IUPAC name of 2,3-dihydroxypropyl 5-methylcyclopenta-1,4-diene-1-carboxylate (CID 173342790) is 2,3-dihydroxypropyl 5-methylcyclopenta-1,4-diene-1-carboxylate.
What is the SMILES notation for 2,3-dihydroxypropyl 5-methylcyclopenta-1,4-diene-1-carboxylate?
The canonical SMILES for 2,3-dihydroxypropyl 5-methylcyclopenta-1,4-diene-1-carboxylate is CC1=CCC=C1C(=O)OCC(O)CO.
What is the InChIKey of 2,3-dihydroxypropyl 5-methylcyclopenta-1,4-diene-1-carboxylate?
The InChIKey is CKRZYFOLYISACL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4/c1-7-3-2-4-9(7)10(13)14-6-8(12)5-11/h3-4,8,11-12H,2,5-6H2,1H3.
What are the key properties of 2,3-dihydroxypropyl 5-methylcyclopenta-1,4-diene-1-carboxylate?
2,3-dihydroxypropyl 5-methylcyclopenta-1,4-diene-1-carboxylate has a molecular weight of 198.22 g/mol, XLogP of 0.16, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxypropyl 5-methylcyclopenta-1,4-diene-1-carboxylate is sourced from PubChem (CID 173342790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).