C11H14O6 — CID 78088469
2,3-dihydroxypropyl 2,4-dihydroxy-6-methylbenzoate (PubChem CID 78088469) has the molecular formula C11H14O6 and a molecular weight of 242.23 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2,4-dihydroxy-6-methylbenzoate.
| Compound Name | 2,3-dihydroxypropyl 2,4-dihydroxy-6-methylbenzoate |
|---|---|
| PubChem CID | 78088469 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2,3-dihydroxypropyl 2,4-dihydroxy-6-methylbenzoate |
| SMILES | Cc1cc(O)cc(O)c1C(=O)OCC(O)CO |
| InChI | InChI=1S/C11H14O6/c1-6-2-7(13)3-9(15)10(6)11(16)17-5-8(14)4-12/h2-3,8,12-15H,4-5H2,1H3 |
| InChIKey | FUTKBYODICXHRE-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |