About 2,3-dihydroxypropyl 2,4-dihydroxy-6-methylbenzoate
2,3-dihydroxypropyl 2,4-dihydroxy-6-methylbenzoate (PubChem CID 78088469) has the molecular formula C11H14O6
and a molecular weight of 242.23 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2,4-dihydroxy-6-methylbenzoate.
Molecular Properties
| Compound Name | 2,3-dihydroxypropyl 2,4-dihydroxy-6-methylbenzoate |
| PubChem CID | 78088469 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2,3-dihydroxypropyl 2,4-dihydroxy-6-methylbenzoate |
| SMILES | Cc1cc(O)cc(O)c1C(=O)OCC(O)CO |
| InChI | InChI=1S/C11H14O6/c1-6-2-7(13)3-9(15)10(6)11(16)17-5-8(14)4-12/h2-3,8,12-15H,4-5H2,1H3 |
| InChIKey | FUTKBYODICXHRE-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,3-dihydroxypropyl 2,4-dihydroxy-6-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxypropyl 2,4-dihydroxy-6-methylbenzoate?
The IUPAC name of 2,3-dihydroxypropyl 2,4-dihydroxy-6-methylbenzoate (CID 78088469) is 2,3-dihydroxypropyl 2,4-dihydroxy-6-methylbenzoate.
What is the SMILES notation for 2,3-dihydroxypropyl 2,4-dihydroxy-6-methylbenzoate?
The canonical SMILES for 2,3-dihydroxypropyl 2,4-dihydroxy-6-methylbenzoate is Cc1cc(O)cc(O)c1C(=O)OCC(O)CO.
What is the InChIKey of 2,3-dihydroxypropyl 2,4-dihydroxy-6-methylbenzoate?
The InChIKey is FUTKBYODICXHRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O6/c1-6-2-7(13)3-9(15)10(6)11(16)17-5-8(14)4-12/h2-3,8,12-15H,4-5H2,1H3.
What are the key properties of 2,3-dihydroxypropyl 2,4-dihydroxy-6-methylbenzoate?
2,3-dihydroxypropyl 2,4-dihydroxy-6-methylbenzoate has a molecular weight of 242.23 g/mol, XLogP of -0.08, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxypropyl 2,4-dihydroxy-6-methylbenzoate is sourced from PubChem (CID 78088469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).