C13H16O6 — CID 163007103
[(4R)-4-hydroxy-2-oxopentyl] 2,4-dihydroxy-6-methylbenzoate (PubChem CID 163007103) has the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. Its IUPAC name is [(4R)-4-hydroxy-2-oxopentyl] 2,4-dihydroxy-6-methylbenzoate.
| Compound Name | [(4R)-4-hydroxy-2-oxopentyl] 2,4-dihydroxy-6-methylbenzoate |
|---|---|
| PubChem CID | 163007103 |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | [(4R)-4-hydroxy-2-oxopentyl] 2,4-dihydroxy-6-methylbenzoate |
| SMILES | Cc1cc(O)cc(O)c1C(=O)OCC(=O)C[C@@H](C)O |
| InChI | InChI=1S/C13H16O6/c1-7-3-9(15)5-11(17)12(7)13(18)19-6-10(16)4-8(2)14/h3,5,8,14-15,17H,4,6H2,1-2H3/t8-/m1/s1 |
| InChIKey | XPROBYNUZWGFGY-MRVPVSSYSA-N |
| XLogP | 0.90 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |