C7H11IN2O — CID 131698603
1-methyl-1,2-dihydropyridin-1-ium-3-carboxamide iodide (PubChem CID 131698603) has the molecular formula C7H11IN2O and a molecular weight of 266.08 g/mol. Its IUPAC name is 1-methyl-1,2-dihydropyridin-1-ium-3-carboxamide iodide.
| Compound Name | 1-methyl-1,2-dihydropyridin-1-ium-3-carboxamide iodide |
|---|---|
| PubChem CID | 131698603 |
| Molecular Formula | C7H11IN2O |
| Molecular Weight | 266.08 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 1-methyl-1,2-dihydropyridin-1-ium-3-carboxamide iodide |
| SMILES | C[NH+]1C=CC=C(C(N)=O)C1.[I-] |
| InChI | InChI=1S/C7H10N2O.HI/c1-9-4-2-3-6(5-9)7(8)10;/h2-4H,5H2,1H3,(H2,8,10);1H |
| InChIKey | NEOWGASAGUVHGE-UHFFFAOYSA-N |
| XLogP | -4.56 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.08 |
| LogP ≤ 5 | -4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|