C9H9NO — CID 155071884
(1E,3Z)-cycloocta-1,3-dien-6-yne-1-carboxamide (PubChem CID 155071884) has the molecular formula C9H9NO and a molecular weight of 147.18 g/mol. Its IUPAC name is (1E,3Z)-cycloocta-1,3-dien-6-yne-1-carboxamide.
| Compound Name | (1E,3Z)-cycloocta-1,3-dien-6-yne-1-carboxamide |
|---|---|
| PubChem CID | 155071884 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | (1E,3Z)-cycloocta-1,3-dien-6-yne-1-carboxamide |
| SMILES | NC(=O)/C1=C/C=C\CC#CC1 |
| InChI | InChI=1S/C9H9NO/c10-9(11)8-6-4-2-1-3-5-7-8/h2,4,6H,1,7H2,(H2,10,11)/b4-2-,8-6+ |
| InChIKey | LOUJVVFNSMOVQV-XSHHVMTCSA-N |
| XLogP | 0.75 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|