About (1E,3Z)-cycloocta-1,3-dien-6-yne-1-carboxamide
(1E,3Z)-cycloocta-1,3-dien-6-yne-1-carboxamide (PubChem CID 155071884) has the molecular formula C9H9NO
and a molecular weight of 147.18 g/mol. Its IUPAC name is (1E,3Z)-cycloocta-1,3-dien-6-yne-1-carboxamide.
Molecular Properties
| Compound Name | (1E,3Z)-cycloocta-1,3-dien-6-yne-1-carboxamide |
| PubChem CID | 155071884 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | (1E,3Z)-cycloocta-1,3-dien-6-yne-1-carboxamide |
| SMILES | NC(=O)/C1=C/C=C\CC#CC1 |
| InChI | InChI=1S/C9H9NO/c10-9(11)8-6-4-2-1-3-5-7-8/h2,4,6H,1,7H2,(H2,10,11)/b4-2-,8-6+ |
| InChIKey | LOUJVVFNSMOVQV-XSHHVMTCSA-N |
| XLogP | 0.75 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (1E,3Z)-cycloocta-1,3-dien-6-yne-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,3Z)-cycloocta-1,3-dien-6-yne-1-carboxamide?
The IUPAC name of (1E,3Z)-cycloocta-1,3-dien-6-yne-1-carboxamide (CID 155071884) is (1E,3Z)-cycloocta-1,3-dien-6-yne-1-carboxamide.
What is the SMILES notation for (1E,3Z)-cycloocta-1,3-dien-6-yne-1-carboxamide?
The canonical SMILES for (1E,3Z)-cycloocta-1,3-dien-6-yne-1-carboxamide is NC(=O)/C1=C/C=C\CC#CC1.
What is the InChIKey of (1E,3Z)-cycloocta-1,3-dien-6-yne-1-carboxamide?
The InChIKey is LOUJVVFNSMOVQV-XSHHVMTCSA-N. The full InChI is InChI=1S/C9H9NO/c10-9(11)8-6-4-2-1-3-5-7-8/h2,4,6H,1,7H2,(H2,10,11)/b4-2-,8-6+.
What are the key properties of (1E,3Z)-cycloocta-1,3-dien-6-yne-1-carboxamide?
(1E,3Z)-cycloocta-1,3-dien-6-yne-1-carboxamide has a molecular weight of 147.18 g/mol, XLogP of 0.75, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,3Z)-cycloocta-1,3-dien-6-yne-1-carboxamide is sourced from PubChem (CID 155071884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).