C7H10N2O — CID 166542377
2,5,6-trideuterio-1-methyl-2H-pyridine-3-carboxamide (PubChem CID 166542377) has the molecular formula C7H10N2O and a molecular weight of 141.19 g/mol. Its IUPAC name is 2,5,6-trideuterio-1-methyl-2H-pyridine-3-carboxamide.
| Compound Name | 2,5,6-trideuterio-1-methyl-2H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166542377 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | 2,5,6-trideuterio-1-methyl-2H-pyridine-3-carboxamide |
| SMILES | [2H]C1=C([2H])N(C)C([2H])C(C(N)=O)=C1 |
| InChI | InChI=1S/C7H10N2O/c1-9-4-2-3-6(5-9)7(8)10/h2-4H,5H2,1H3,(H2,8,10)/i2D,4D,5D |
| InChIKey | CRJFOPZHQMBHNQ-KXXDXSMKSA-N |
| XLogP | -0.14 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |