C7H12N2O — CID 54118200
1-methyl-3,4-dihydro-2H-pyridine-3-carboxamide (PubChem CID 54118200) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is 1-methyl-3,4-dihydro-2H-pyridine-3-carboxamide.
| Compound Name | 1-methyl-3,4-dihydro-2H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 54118200 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 1-methyl-3,4-dihydro-2H-pyridine-3-carboxamide |
| SMILES | CN1C=CCC(C(N)=O)C1 |
| InChI | InChI=1S/C7H12N2O/c1-9-4-2-3-6(5-9)7(8)10/h2,4,6H,3,5H2,1H3,(H2,8,10) |
| InChIKey | NLUVTOMLDQXKEJ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |