About 1-N,1-N-dimethylazetidine-1,3-dicarboxamide
1-N,1-N-dimethylazetidine-1,3-dicarboxamide (PubChem CID 130950203) has the molecular formula C7H13N3O2
and a molecular weight of 171.20 g/mol. Its IUPAC name is 1-N,1-N-dimethylazetidine-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 1-N,1-N-dimethylazetidine-1,3-dicarboxamide |
| PubChem CID | 130950203 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 1-N,1-N-dimethylazetidine-1,3-dicarboxamide |
| SMILES | CN(C)C(=O)N1CC(C(N)=O)C1 |
| InChI | InChI=1S/C7H13N3O2/c1-9(2)7(12)10-3-5(4-10)6(8)11/h5H,3-4H2,1-2H3,(H2,8,11) |
| InChIKey | PXURQBXOBVYXLP-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-N,1-N-dimethylazetidine-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,1-N-dimethylazetidine-1,3-dicarboxamide?
The IUPAC name of 1-N,1-N-dimethylazetidine-1,3-dicarboxamide (CID 130950203) is 1-N,1-N-dimethylazetidine-1,3-dicarboxamide.
What is the SMILES notation for 1-N,1-N-dimethylazetidine-1,3-dicarboxamide?
The canonical SMILES for 1-N,1-N-dimethylazetidine-1,3-dicarboxamide is CN(C)C(=O)N1CC(C(N)=O)C1.
What is the InChIKey of 1-N,1-N-dimethylazetidine-1,3-dicarboxamide?
The InChIKey is PXURQBXOBVYXLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O2/c1-9(2)7(12)10-3-5(4-10)6(8)11/h5H,3-4H2,1-2H3,(H2,8,11).
What are the key properties of 1-N,1-N-dimethylazetidine-1,3-dicarboxamide?
1-N,1-N-dimethylazetidine-1,3-dicarboxamide has a molecular weight of 171.20 g/mol, XLogP of -0.91, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,1-N-dimethylazetidine-1,3-dicarboxamide is sourced from PubChem (CID 130950203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).