C8H13N3O2 — CID 131048719
1-N-cyclopropylazetidine-1,3-dicarboxamide (PubChem CID 131048719) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 1-N-cyclopropylazetidine-1,3-dicarboxamide.
| Compound Name | 1-N-cyclopropylazetidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 131048719 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 1-N-cyclopropylazetidine-1,3-dicarboxamide |
| SMILES | NC(=O)C1CN(C(=O)NC2CC2)C1 |
| InChI | InChI=1S/C8H13N3O2/c9-7(12)5-3-11(4-5)8(13)10-6-1-2-6/h5-6H,1-4H2,(H2,9,12)(H,10,13) |
| InChIKey | OREXFSUDWFPARD-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |