C14H23N3O4 — CID 61193762
4-[(4-carbamoylpiperidine-1-carbonyl)amino]cyclohexane-1-carboxylic acid (PubChem CID 61193762) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is 4-[(4-carbamoylpiperidine-1-carbonyl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(4-carbamoylpiperidine-1-carbonyl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 61193762 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 4-[(4-carbamoylpiperidine-1-carbonyl)amino]cyclohexane-1-carboxylic acid |
| SMILES | NC(=O)C1CCN(C(=O)NC2CCC(C(=O)O)CC2)CC1 |
| InChI | InChI=1S/C14H23N3O4/c15-12(18)9-5-7-17(8-6-9)14(21)16-11-3-1-10(2-4-11)13(19)20/h9-11H,1-8H2,(H2,15,18)(H,16,21)(H,19,20) |
| InChIKey | SPMFOSOIFQEXKU-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |