C19H33N3O4 — CID 122025052
4-[[4-[butyl(methyl)carbamoyl]piperidine-1-carbonyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 122025052) has the molecular formula C19H33N3O4 and a molecular weight of 367.49 g/mol. Its IUPAC name is 4-[[4-[butyl(methyl)carbamoyl]piperidine-1-carbonyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[4-[butyl(methyl)carbamoyl]piperidine-1-carbonyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122025052 |
| Molecular Formula | C19H33N3O4 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 4-[[4-[butyl(methyl)carbamoyl]piperidine-1-carbonyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | CCCCN(C)C(=O)C1CCN(C(=O)NC2CCC(C(=O)O)CC2)CC1 |
| InChI | InChI=1S/C19H33N3O4/c1-3-4-11-21(2)17(23)14-9-12-22(13-10-14)19(26)20-16-7-5-15(6-8-16)18(24)25/h14-16H,3-13H2,1-2H3,(H,20,26)(H,24,25) |
| InChIKey | MNBBEEYLGKIDPD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |