About 1-methyl-4-oxo-2,3-dihydropyridine-3-carboxamide
1-methyl-4-oxo-2,3-dihydropyridine-3-carboxamide (PubChem CID 175819139) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is 1-methyl-4-oxo-2,3-dihydropyridine-3-carboxamide.
Molecular Properties
| Compound Name | 1-methyl-4-oxo-2,3-dihydropyridine-3-carboxamide |
| PubChem CID | 175819139 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 1-methyl-4-oxo-2,3-dihydropyridine-3-carboxamide |
| SMILES | CN1C=CC(=O)C(C(N)=O)C1 |
| InChI | InChI=1S/C7H10N2O2/c1-9-3-2-6(10)5(4-9)7(8)11/h2-3,5H,4H2,1H3,(H2,8,11) |
| InChIKey | HXTMATFYEBDSKJ-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-oxo-2,3-dihydropyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-oxo-2,3-dihydropyridine-3-carboxamide?
The IUPAC name of 1-methyl-4-oxo-2,3-dihydropyridine-3-carboxamide (CID 175819139) is 1-methyl-4-oxo-2,3-dihydropyridine-3-carboxamide.
What is the SMILES notation for 1-methyl-4-oxo-2,3-dihydropyridine-3-carboxamide?
The canonical SMILES for 1-methyl-4-oxo-2,3-dihydropyridine-3-carboxamide is CN1C=CC(=O)C(C(N)=O)C1.
What is the InChIKey of 1-methyl-4-oxo-2,3-dihydropyridine-3-carboxamide?
The InChIKey is HXTMATFYEBDSKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-9-3-2-6(10)5(4-9)7(8)11/h2-3,5H,4H2,1H3,(H2,8,11).
What are the key properties of 1-methyl-4-oxo-2,3-dihydropyridine-3-carboxamide?
1-methyl-4-oxo-2,3-dihydropyridine-3-carboxamide has a molecular weight of 154.17 g/mol, XLogP of -0.88, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-oxo-2,3-dihydropyridine-3-carboxamide is sourced from PubChem (CID 175819139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).