C9H13NO2 — CID 140979530
5,5-dimethyl-2-oxocyclohex-3-ene-1-carboxamide (PubChem CID 140979530) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 5,5-dimethyl-2-oxocyclohex-3-ene-1-carboxamide.
| Compound Name | 5,5-dimethyl-2-oxocyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 140979530 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 5,5-dimethyl-2-oxocyclohex-3-ene-1-carboxamide |
| SMILES | CC1(C)C=CC(=O)C(C(N)=O)C1 |
| InChI | InChI=1S/C9H13NO2/c1-9(2)4-3-7(11)6(5-9)8(10)12/h3-4,6H,5H2,1-2H3,(H2,10,12) |
| InChIKey | WSLYYOHFZYYHFR-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|