C13H23NO — CID 18320134
6-(diethylaminomethyl)-4,4-dimethylcyclohex-2-en-1-one (PubChem CID 18320134) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 6-(diethylaminomethyl)-4,4-dimethylcyclohex-2-en-1-one.
| Compound Name | 6-(diethylaminomethyl)-4,4-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 18320134 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 6-(diethylaminomethyl)-4,4-dimethylcyclohex-2-en-1-one |
| SMILES | CCN(CC)CC1CC(C)(C)C=CC1=O |
| InChI | InChI=1S/C13H23NO/c1-5-14(6-2)10-11-9-13(3,4)8-7-12(11)15/h7-8,11H,5-6,9-10H2,1-4H3 |
| InChIKey | HVOPWJXWAHJPDZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |