C7H11NO — CID 134956033
1,3-dimethyl-2,3-dihydropyridin-4-one (PubChem CID 134956033) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is 1,3-dimethyl-2,3-dihydropyridin-4-one.
| Compound Name | 1,3-dimethyl-2,3-dihydropyridin-4-one |
|---|---|
| PubChem CID | 134956033 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 1,3-dimethyl-2,3-dihydropyridin-4-one |
| SMILES | CC1CN(C)C=CC1=O |
| InChI | InChI=1S/C7H11NO/c1-6-5-8(2)4-3-7(6)9/h3-4,6H,5H2,1-2H3 |
| InChIKey | ALCLTYLTYJDOMD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |