About acetaldehyde;1,6-dimethylpiperidine-3-carboxamide
acetaldehyde;1,6-dimethylpiperidine-3-carboxamide (PubChem CID 156717131) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is acetaldehyde;1,6-dimethylpiperidine-3-carboxamide.
Molecular Properties
| Compound Name | acetaldehyde;1,6-dimethylpiperidine-3-carboxamide |
| PubChem CID | 156717131 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | acetaldehyde;1,6-dimethylpiperidine-3-carboxamide |
| SMILES | CC1CCC(C(N)=O)CN1C.CC=O |
| InChI | InChI=1S/C8H16N2O.C2H4O/c1-6-3-4-7(8(9)11)5-10(6)2;1-2-3/h6-7H,3-5H2,1-2H3,(H2,9,11);2H,1H3 |
| InChIKey | LTUVMMLWXJYKPQ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;1,6-dimethylpiperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;1,6-dimethylpiperidine-3-carboxamide?
The IUPAC name of acetaldehyde;1,6-dimethylpiperidine-3-carboxamide (CID 156717131) is acetaldehyde;1,6-dimethylpiperidine-3-carboxamide.
What is the SMILES notation for acetaldehyde;1,6-dimethylpiperidine-3-carboxamide?
The canonical SMILES for acetaldehyde;1,6-dimethylpiperidine-3-carboxamide is CC1CCC(C(N)=O)CN1C.CC=O.
What is the InChIKey of acetaldehyde;1,6-dimethylpiperidine-3-carboxamide?
The InChIKey is LTUVMMLWXJYKPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O.C2H4O/c1-6-3-4-7(8(9)11)5-10(6)2;1-2-3/h6-7H,3-5H2,1-2H3,(H2,9,11);2H,1H3.
What are the key properties of acetaldehyde;1,6-dimethylpiperidine-3-carboxamide?
acetaldehyde;1,6-dimethylpiperidine-3-carboxamide has a molecular weight of 200.28 g/mol, XLogP of 0.41, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;1,6-dimethylpiperidine-3-carboxamide is sourced from PubChem (CID 156717131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).