(6R)-1,6-dimethylpiperidine-3-carboxylic acid

C8H15NO2 — CID 145074333

IUPAC(6R)-1,6-dimethylpiperidine-3-carboxylic acid
SMILESC[C@@H]1CCC(C(=O)O)CN1C
InChIInChI=1S/C8H15NO2/c1-6-3-4-7(8(10)11)5-9(6)2/h6-7H,3-5H2,1-2H3,(H,10,11)/t6-,7?/m1/s1
InChIKeyKAFUJNCMLYVTKS-ULUSZKPHSA-N
MW157.21 g/mol
LogP0.80
Rot. Bonds1

About (6R)-1,6-dimethylpiperidine-3-carboxylic acid

(6R)-1,6-dimethylpiperidine-3-carboxylic acid (PubChem CID 145074333) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is (6R)-1,6-dimethylpiperidine-3-carboxylic acid.

Molecular Properties

Compound Name(6R)-1,6-dimethylpiperidine-3-carboxylic acid
PubChem CID145074333
Molecular FormulaC8H15NO2
Molecular Weight157.21 g/mol
Exact Mass157.11
IUPAC Name(6R)-1,6-dimethylpiperidine-3-carboxylic acid
SMILESC[C@@H]1CCC(C(=O)O)CN1C
InChIInChI=1S/C8H15NO2/c1-6-3-4-7(8(10)11)5-9(6)2/h6-7H,3-5H2,1-2H3,(H,10,11)/t6-,7?/m1/s1
InChIKeyKAFUJNCMLYVTKS-ULUSZKPHSA-N
XLogP0.80
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.21
LogP ≤ 50.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (6R)-1,6-dimethylpiperidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (6R)-1,6-dimethylpiperidine-3-carboxylic acid?
The IUPAC name of (6R)-1,6-dimethylpiperidine-3-carboxylic acid (CID 145074333) is (6R)-1,6-dimethylpiperidine-3-carboxylic acid.
What is the SMILES notation for (6R)-1,6-dimethylpiperidine-3-carboxylic acid?
The canonical SMILES for (6R)-1,6-dimethylpiperidine-3-carboxylic acid is C[C@@H]1CCC(C(=O)O)CN1C.
What is the InChIKey of (6R)-1,6-dimethylpiperidine-3-carboxylic acid?
The InChIKey is KAFUJNCMLYVTKS-ULUSZKPHSA-N. The full InChI is InChI=1S/C8H15NO2/c1-6-3-4-7(8(10)11)5-9(6)2/h6-7H,3-5H2,1-2H3,(H,10,11)/t6-,7?/m1/s1.
What are the key properties of (6R)-1,6-dimethylpiperidine-3-carboxylic acid?
(6R)-1,6-dimethylpiperidine-3-carboxylic acid has a molecular weight of 157.21 g/mol, XLogP of 0.80, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-1,6-dimethylpiperidine-3-carboxylic acid is sourced from PubChem (CID 145074333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).