C12H20N2O — CID 115873029
6-methyl-1-pent-4-ynylpiperidine-3-carboxamide (PubChem CID 115873029) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 6-methyl-1-pent-4-ynylpiperidine-3-carboxamide.
| Compound Name | 6-methyl-1-pent-4-ynylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 115873029 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 6-methyl-1-pent-4-ynylpiperidine-3-carboxamide |
| SMILES | C#CCCCN1CC(C(N)=O)CCC1C |
| InChI | InChI=1S/C12H20N2O/c1-3-4-5-8-14-9-11(12(13)15)7-6-10(14)2/h1,10-11H,4-9H2,2H3,(H2,13,15) |
| InChIKey | KIBSYSFZHXUUNV-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|