C15H22N2O2 — CID 95342008
(3S,6R)-6-methyl-1-(2-phenoxyethyl)piperidine-3-carboxamide (PubChem CID 95342008) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is (3S,6R)-6-methyl-1-(2-phenoxyethyl)piperidine-3-carboxamide.
| Compound Name | (3S,6R)-6-methyl-1-(2-phenoxyethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95342008 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (3S,6R)-6-methyl-1-(2-phenoxyethyl)piperidine-3-carboxamide |
| SMILES | C[C@@H]1CC[C@H](C(N)=O)CN1CCOc1ccccc1 |
| InChI | InChI=1S/C15H22N2O2/c1-12-7-8-13(15(16)18)11-17(12)9-10-19-14-5-3-2-4-6-14/h2-6,12-13H,7-11H2,1H3,(H2,16,18)/t12-,13+/m1/s1 |
| InChIKey | XMSCKXBUEPIWTI-OLZOCXBDSA-N |
| XLogP | 1.65 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |