C19H26N2O4 — CID 94820119
(3S,6R)-1-[4-(3-acetylphenoxy)butanoyl]-6-methylpiperidine-3-carboxamide (PubChem CID 94820119) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is (3S,6R)-1-[4-(3-acetylphenoxy)butanoyl]-6-methylpiperidine-3-carboxamide.
| Compound Name | (3S,6R)-1-[4-(3-acetylphenoxy)butanoyl]-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 94820119 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | (3S,6R)-1-[4-(3-acetylphenoxy)butanoyl]-6-methylpiperidine-3-carboxamide |
| SMILES | CC(=O)c1cccc(OCCCC(=O)N2C[C@@H](C(N)=O)CC[C@H]2C)c1 |
| InChI | InChI=1S/C19H26N2O4/c1-13-8-9-16(19(20)24)12-21(13)18(23)7-4-10-25-17-6-3-5-15(11-17)14(2)22/h3,5-6,11,13,16H,4,7-10,12H2,1-2H3,(H2,20,24)/t13-,16+/m1/s1 |
| InChIKey | YYFVDEFBTXKKJJ-CJNGLKHVSA-N |
| XLogP | 2.16 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|