C18H23NO5 — CID 119166436
1-[4-(3-acetylphenoxy)butanoyl]piperidine-4-carboxylic acid (PubChem CID 119166436) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is 1-[4-(3-acetylphenoxy)butanoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[4-(3-acetylphenoxy)butanoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119166436 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 1-[4-(3-acetylphenoxy)butanoyl]piperidine-4-carboxylic acid |
| SMILES | CC(=O)c1cccc(OCCCC(=O)N2CCC(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C18H23NO5/c1-13(20)15-4-2-5-16(12-15)24-11-3-6-17(21)19-9-7-14(8-10-19)18(22)23/h2,4-5,12,14H,3,6-11H2,1H3,(H,22,23) |
| InChIKey | ZJPKQOLRIDKGKJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|