C18H32BrN — CID 139793988
5-bromo-5-dodecylcyclohexa-1,3-dien-1-amine (PubChem CID 139793988) has the molecular formula C18H32BrN and a molecular weight of 342.37 g/mol. Its IUPAC name is 5-bromo-5-dodecylcyclohexa-1,3-dien-1-amine.
| Compound Name | 5-bromo-5-dodecylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 139793988 |
| Molecular Formula | C18H32BrN |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 5-bromo-5-dodecylcyclohexa-1,3-dien-1-amine |
| SMILES | CCCCCCCCCCCCC1(Br)C=CC=C(N)C1 |
| InChI | InChI=1S/C18H32BrN/c1-2-3-4-5-6-7-8-9-10-11-14-18(19)15-12-13-17(20)16-18/h12-13,15H,2-11,14,16,20H2,1H3 |
| InChIKey | NTRNQFSBIFKSLI-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|