C19H26O — CID 67779505
5-benzyl-5-hexylcyclohexa-1,3-dien-1-ol (PubChem CID 67779505) has the molecular formula C19H26O and a molecular weight of 270.42 g/mol. Its IUPAC name is 5-benzyl-5-hexylcyclohexa-1,3-dien-1-ol.
| Compound Name | 5-benzyl-5-hexylcyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 67779505 |
| Molecular Formula | C19H26O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | 5-benzyl-5-hexylcyclohexa-1,3-dien-1-ol |
| SMILES | CCCCCCC1(Cc2ccccc2)C=CC=C(O)C1 |
| InChI | InChI=1S/C19H26O/c1-2-3-4-8-13-19(14-9-12-18(20)16-19)15-17-10-6-5-7-11-17/h5-7,9-12,14,20H,2-4,8,13,15-16H2,1H3 |
| InChIKey | VYOSVKWWSDMTTG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|