C14H26NO2P — CID 142733319
5-[amino(ethoxy)phosphoryl]-5-tert-butyl-1,3-dimethylcyclohexa-1,3-diene (PubChem CID 142733319) has the molecular formula C14H26NO2P and a molecular weight of 271.34 g/mol. Its IUPAC name is 5-[amino(ethoxy)phosphoryl]-5-tert-butyl-1,3-dimethylcyclohexa-1,3-diene.
| Compound Name | 5-[amino(ethoxy)phosphoryl]-5-tert-butyl-1,3-dimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142733319 |
| Molecular Formula | C14H26NO2P |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 5-[amino(ethoxy)phosphoryl]-5-tert-butyl-1,3-dimethylcyclohexa-1,3-diene |
| SMILES | CCOP(N)(=O)C1(C(C)(C)C)C=C(C)C=C(C)C1 |
| InChI | InChI=1S/C14H26NO2P/c1-7-17-18(15,16)14(13(4,5)6)9-11(2)8-12(3)10-14/h8-9H,7,10H2,1-6H3,(H2,15,16) |
| InChIKey | LRGDNUVNSANGNO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|