C15H24F3NO6P2 — CID 101468435
2,6-bis(diethoxyphosphoryl)-4-(trifluoromethyl)aniline (PubChem CID 101468435) has the molecular formula C15H24F3NO6P2 and a molecular weight of 433.30 g/mol. Its IUPAC name is 2,6-bis(diethoxyphosphoryl)-4-(trifluoromethyl)aniline.
| Compound Name | 2,6-bis(diethoxyphosphoryl)-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 101468435 |
| Molecular Formula | C15H24F3NO6P2 |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 2,6-bis(diethoxyphosphoryl)-4-(trifluoromethyl)aniline |
| SMILES | CCOP(=O)(OCC)c1cc(C(F)(F)F)cc(P(=O)(OCC)OCC)c1N |
| InChI | InChI=1S/C15H24F3NO6P2/c1-5-22-26(20,23-6-2)12-9-11(15(16,17)18)10-13(14(12)19)27(21,24-7-3)25-8-4/h9-10H,5-8,19H2,1-4H3 |
| InChIKey | UWYGAPBAJDNBHW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|