C14H16F3N2O3P — CID 102290576
5-diethoxyphosphoryl-3-[4-(trifluoromethyl)phenyl]-1H-pyrazole (PubChem CID 102290576) has the molecular formula C14H16F3N2O3P and a molecular weight of 348.26 g/mol. Its IUPAC name is 5-diethoxyphosphoryl-3-[4-(trifluoromethyl)phenyl]-1H-pyrazole.
| Compound Name | 5-diethoxyphosphoryl-3-[4-(trifluoromethyl)phenyl]-1H-pyrazole |
|---|---|
| PubChem CID | 102290576 |
| Molecular Formula | C14H16F3N2O3P |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 5-diethoxyphosphoryl-3-[4-(trifluoromethyl)phenyl]-1H-pyrazole |
| SMILES | CCOP(=O)(OCC)c1cc(-c2ccc(C(F)(F)F)cc2)n[nH]1 |
| InChI | InChI=1S/C14H16F3N2O3P/c1-3-21-23(20,22-4-2)13-9-12(18-19-13)10-5-7-11(8-6-10)14(15,16)17/h5-9H,3-4H2,1-2H3,(H,18,19) |
| InChIKey | BNFTUGFGKTURMK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|