C15H22F3O3P — CID 171093081
1-(1-diethoxyphosphoryl-2-methylpropan-2-yl)-4-(trifluoromethyl)benzene (PubChem CID 171093081) has the molecular formula C15H22F3O3P and a molecular weight of 338.31 g/mol. Its IUPAC name is 1-(1-diethoxyphosphoryl-2-methylpropan-2-yl)-4-(trifluoromethyl)benzene.
| Compound Name | 1-(1-diethoxyphosphoryl-2-methylpropan-2-yl)-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 171093081 |
| Molecular Formula | C15H22F3O3P |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 1-(1-diethoxyphosphoryl-2-methylpropan-2-yl)-4-(trifluoromethyl)benzene |
| SMILES | CCOP(=O)(CC(C)(C)c1ccc(C(F)(F)F)cc1)OCC |
| InChI | InChI=1S/C15H22F3O3P/c1-5-20-22(19,21-6-2)11-14(3,4)12-7-9-13(10-8-12)15(16,17)18/h7-10H,5-6,11H2,1-4H3 |
| InChIKey | HEPUDASWNAPRHU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|