C20H23F3NO3P — CID 76701477
N-(diethoxyphosphorylmethyl)-1-(4-methylphenyl)-1-[4-(trifluoromethyl)phenyl]methanimine (PubChem CID 76701477) has the molecular formula C20H23F3NO3P and a molecular weight of 413.38 g/mol. Its IUPAC name is N-(diethoxyphosphorylmethyl)-1-(4-methylphenyl)-1-[4-(trifluoromethyl)phenyl]methanimine.
| Compound Name | N-(diethoxyphosphorylmethyl)-1-(4-methylphenyl)-1-[4-(trifluoromethyl)phenyl]methanimine |
|---|---|
| PubChem CID | 76701477 |
| Molecular Formula | C20H23F3NO3P |
| Molecular Weight | 413.38 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N-(diethoxyphosphorylmethyl)-1-(4-methylphenyl)-1-[4-(trifluoromethyl)phenyl]methanimine |
| SMILES | CCOP(=O)(CN=C(c1ccc(C)cc1)c1ccc(C(F)(F)F)cc1)OCC |
| InChI | InChI=1S/C20H23F3NO3P/c1-4-26-28(25,27-5-2)14-24-19(16-8-6-15(3)7-9-16)17-10-12-18(13-11-17)20(21,22)23/h6-13H,4-5,14H2,1-3H3 |
| InChIKey | LYSFJFPABVTRLB-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.38 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|