C11H8F4N2 — CID 151151605
5-(fluoromethyl)-3-[4-(trifluoromethyl)phenyl]-1H-pyrazole (PubChem CID 151151605) has the molecular formula C11H8F4N2 and a molecular weight of 244.19 g/mol. Its IUPAC name is 5-(fluoromethyl)-3-[4-(trifluoromethyl)phenyl]-1H-pyrazole.
| Compound Name | 5-(fluoromethyl)-3-[4-(trifluoromethyl)phenyl]-1H-pyrazole |
|---|---|
| PubChem CID | 151151605 |
| Molecular Formula | C11H8F4N2 |
| Molecular Weight | 244.19 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 5-(fluoromethyl)-3-[4-(trifluoromethyl)phenyl]-1H-pyrazole |
| SMILES | FCc1cc(-c2ccc(C(F)(F)F)cc2)n[nH]1 |
| InChI | InChI=1S/C11H8F4N2/c12-6-9-5-10(17-16-9)7-1-3-8(4-2-7)11(13,14)15/h1-5H,6H2,(H,16,17) |
| InChIKey | MYIMPNOYUZVFJZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.19 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |