C20H13F3N2O2 — CID 156772921
3-[[3-[4-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]methyl]-3H-indene-1,2-dione (PubChem CID 156772921) has the molecular formula C20H13F3N2O2 and a molecular weight of 370.33 g/mol. Its IUPAC name is 3-[[3-[4-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]methyl]-3H-indene-1,2-dione.
| Compound Name | 3-[[3-[4-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]methyl]-3H-indene-1,2-dione |
|---|---|
| PubChem CID | 156772921 |
| Molecular Formula | C20H13F3N2O2 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 3-[[3-[4-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]methyl]-3H-indene-1,2-dione |
| SMILES | O=C1C(=O)C(Cc2cc(-c3ccc(C(F)(F)F)cc3)n[nH]2)c2ccccc21 |
| InChI | InChI=1S/C20H13F3N2O2/c21-20(22,23)12-7-5-11(6-8-12)17-10-13(24-25-17)9-16-14-3-1-2-4-15(14)18(26)19(16)27/h1-8,10,16H,9H2,(H,24,25) |
| InChIKey | AMOLJOXECLWLCI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|