C20H20F3N2O3P — CID 15466473
3-diethoxyphosphoryl-N-phenyl-7-(trifluoromethyl)quinolin-4-amine (PubChem CID 15466473) has the molecular formula C20H20F3N2O3P and a molecular weight of 424.36 g/mol. Its IUPAC name is 3-diethoxyphosphoryl-N-phenyl-7-(trifluoromethyl)quinolin-4-amine.
| Compound Name | 3-diethoxyphosphoryl-N-phenyl-7-(trifluoromethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 15466473 |
| Molecular Formula | C20H20F3N2O3P |
| Molecular Weight | 424.36 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 3-diethoxyphosphoryl-N-phenyl-7-(trifluoromethyl)quinolin-4-amine |
| SMILES | CCOP(=O)(OCC)c1cnc2cc(C(F)(F)F)ccc2c1Nc1ccccc1 |
| InChI | InChI=1S/C20H20F3N2O3P/c1-3-27-29(26,28-4-2)18-13-24-17-12-14(20(21,22)23)10-11-16(17)19(18)25-15-8-6-5-7-9-15/h5-13H,3-4H2,1-2H3,(H,24,25) |
| InChIKey | SBYBKKYPMMFWRP-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.36 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|