C17H25BF3O5P — CID 166610082
2-[2-diethoxyphosphoryl-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 166610082) has the molecular formula C17H25BF3O5P and a molecular weight of 408.16 g/mol. Its IUPAC name is 2-[2-diethoxyphosphoryl-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-diethoxyphosphoryl-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 166610082 |
| Molecular Formula | C17H25BF3O5P |
| Molecular Weight | 408.16 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 2-[2-diethoxyphosphoryl-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCOP(=O)(OCC)c1cc(C(F)(F)F)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H25BF3O5P/c1-7-23-27(22,24-8-2)14-11-12(17(19,20)21)9-10-13(14)18-25-15(3,4)16(5,6)26-18/h9-11H,7-8H2,1-6H3 |
| InChIKey | WRHGYDUKCAKBLK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.16 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|