C10H12O3S — CID 142401402
3,5,7-trimethyl-3H-2,1λ6-benzoxathiole 1,1-dioxide (PubChem CID 142401402) has the molecular formula C10H12O3S and a molecular weight of 212.27 g/mol. Its IUPAC name is 3,5,7-trimethyl-3H-2,1λ6-benzoxathiole 1,1-dioxide.
| Compound Name | 3,5,7-trimethyl-3H-2,1λ6-benzoxathiole 1,1-dioxide |
|---|---|
| PubChem CID | 142401402 |
| Molecular Formula | C10H12O3S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 3,5,7-trimethyl-3H-2,1λ6-benzoxathiole 1,1-dioxide |
| SMILES | Cc1cc(C)c2c(c1)C(C)OS2(=O)=O |
| InChI | InChI=1S/C10H12O3S/c1-6-4-7(2)10-9(5-6)8(3)13-14(10,11)12/h4-5,8H,1-3H3 |
| InChIKey | LHKODKDBSPHCCQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|