About CID 158647642
CID 158647642 (PubChem CID 158647642) has the molecular formula C36H40AlO4-
and a molecular weight of 563.69 g/mol.
Molecular Properties
| Compound Name | CID 158647642 |
| PubChem CID | 158647642 |
| Molecular Formula | C36H40AlO4- |
| Molecular Weight | 563.69 g/mol |
| Exact Mass | 563.27 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c2c(c1)C(C)c1cc(C)cc(C)c1O[Al-]1(O2)Oc2c(C)cc(C)cc2C(C)c2cc(C)cc(C)c2O1 |
| InChI | InChI=1S/2C18H22O2.Al/c2*1-10-6-12(3)17(19)15(8-10)14(5)16-9-11(2)7-13(4)18(16)20;/h2*6-9,14,19-20H,1-5H3;/q;;+3/p-4 |
| InChIKey | HNPDHVZXBLSLRX-UHFFFAOYSA-J |
| XLogP | 9.14 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 563.69 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 158647642 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158647642?
The IUPAC name of CID 158647642 (CID 158647642) is not available.
What is the SMILES notation for CID 158647642?
The canonical SMILES for CID 158647642 is Cc1cc(C)c2c(c1)C(C)c1cc(C)cc(C)c1O[Al-]1(O2)Oc2c(C)cc(C)cc2C(C)c2cc(C)cc(C)c2O1.
What is the InChIKey of CID 158647642?
The InChIKey is HNPDHVZXBLSLRX-UHFFFAOYSA-J. The full InChI is InChI=1S/2C18H22O2.Al/c2*1-10-6-12(3)17(19)15(8-10)14(5)16-9-11(2)7-13(4)18(16)20;/h2*6-9,14,19-20H,1-5H3;/q;;+3/p-4.
What are the key properties of CID 158647642?
CID 158647642 has a molecular weight of 563.69 g/mol, XLogP of 9.14, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158647642 is sourced from PubChem (CID 158647642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).