C15H18O — CID 11378895
(3aS,9bR)-6,8-dimethyl-1,2,3,3a,4,9b-hexahydrocyclopenta[a]naphthalen-5-one (PubChem CID 11378895) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is (3aS,9bR)-6,8-dimethyl-1,2,3,3a,4,9b-hexahydrocyclopenta[a]naphthalen-5-one.
| Compound Name | (3aS,9bR)-6,8-dimethyl-1,2,3,3a,4,9b-hexahydrocyclopenta[a]naphthalen-5-one |
|---|---|
| PubChem CID | 11378895 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | (3aS,9bR)-6,8-dimethyl-1,2,3,3a,4,9b-hexahydrocyclopenta[a]naphthalen-5-one |
| SMILES | Cc1cc(C)c2c(c1)[C@@H]1CCC[C@H]1CC2=O |
| InChI | InChI=1S/C15H18O/c1-9-6-10(2)15-13(7-9)12-5-3-4-11(12)8-14(15)16/h6-7,11-12H,3-5,8H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | WCQLRPFEOHXTSL-NWDGAFQWSA-N |
| XLogP | 3.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |