C17H22O2 — CID 162788293
2-methyl-2,3,4,7,7a,8,9,10,10a,11-decahydroindeno[5,6-h]chromen-5-ol (PubChem CID 162788293) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-methyl-2,3,4,7,7a,8,9,10,10a,11-decahydroindeno[5,6-h]chromen-5-ol.
| Compound Name | 2-methyl-2,3,4,7,7a,8,9,10,10a,11-decahydroindeno[5,6-h]chromen-5-ol |
|---|---|
| PubChem CID | 162788293 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 2-methyl-2,3,4,7,7a,8,9,10,10a,11-decahydroindeno[5,6-h]chromen-5-ol |
| SMILES | CC1CCc2c(O)cc3c(c2O1)CC1CCCC1C3 |
| InChI | InChI=1S/C17H22O2/c1-10-5-6-14-16(18)9-13-7-11-3-2-4-12(11)8-15(13)17(14)19-10/h9-12,18H,2-8H2,1H3 |
| InChIKey | HARXLBYWPKUNGS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |