C18H20O8 — CID 91238537
(2R,4R,12S)-8,16,18-trihydroxy-12-methyl-3,13-dioxatricyclo[13.4.0.02,4]nonadeca-1(15),16,18-triene-6,7,14-trione (PubChem CID 91238537) has the molecular formula C18H20O8 and a molecular weight of 364.35 g/mol. Its IUPAC name is (2R,4R,12S)-8,16,18-trihydroxy-12-methyl-3,13-dioxatricyclo[13.4.0.02,4]nonadeca-1(15),16,18-triene-6,7,14-trione.
| Compound Name | (2R,4R,12S)-8,16,18-trihydroxy-12-methyl-3,13-dioxatricyclo[13.4.0.02,4]nonadeca-1(15),16,18-triene-6,7,14-trione |
|---|---|
| PubChem CID | 91238537 |
| Molecular Formula | C18H20O8 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (2R,4R,12S)-8,16,18-trihydroxy-12-methyl-3,13-dioxatricyclo[13.4.0.02,4]nonadeca-1(15),16,18-triene-6,7,14-trione |
| SMILES | C[C@H]1CCCC(O)C(=O)C(=O)C[C@H]2O[C@@H]2c2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C18H20O8/c1-8-3-2-4-11(20)16(23)13(22)7-14-17(26-14)10-5-9(19)6-12(21)15(10)18(24)25-8/h5-6,8,11,14,17,19-21H,2-4,7H2,1H3/t8-,11?,14+,17+/m0/s1 |
| InChIKey | YNNAPFRVZKOBFN-ICYQJFGQSA-N |
| XLogP | 1.16 |
| TPSA | 133.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|