About 2,5,7-trimethyl-3,4-dihydro-2H-thieno[3,4-b]pyran
2,5,7-trimethyl-3,4-dihydro-2H-thieno[3,4-b]pyran (PubChem CID 155032390) has the molecular formula C10H14OS
and a molecular weight of 182.29 g/mol. Its IUPAC name is 2,5,7-trimethyl-3,4-dihydro-2H-thieno[3,4-b]pyran.
Analyze 2,5,7-trimethyl-3,4-dihydro-2H-thieno[3,4-b]pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5,7-trimethyl-3,4-dihydro-2H-thieno[3,4-b]pyran?
The IUPAC name of 2,5,7-trimethyl-3,4-dihydro-2H-thieno[3,4-b]pyran (CID 155032390) is 2,5,7-trimethyl-3,4-dihydro-2H-thieno[3,4-b]pyran.
What is the SMILES notation for 2,5,7-trimethyl-3,4-dihydro-2H-thieno[3,4-b]pyran?
The canonical SMILES for 2,5,7-trimethyl-3,4-dihydro-2H-thieno[3,4-b]pyran is Cc1sc(C)c2c1CCC(C)O2.
What is the InChIKey of 2,5,7-trimethyl-3,4-dihydro-2H-thieno[3,4-b]pyran?
The InChIKey is OHUMMJFIULVMCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14OS/c1-6-4-5-9-7(2)12-8(3)10(9)11-6/h6H,4-5H2,1-3H3.
What are the key properties of 2,5,7-trimethyl-3,4-dihydro-2H-thieno[3,4-b]pyran?
2,5,7-trimethyl-3,4-dihydro-2H-thieno[3,4-b]pyran has a molecular weight of 182.29 g/mol, XLogP of 3.08, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5,7-trimethyl-3,4-dihydro-2H-thieno[3,4-b]pyran is sourced from PubChem (CID 155032390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).