C24H44O2SSn — CID 11071330
tributyl-(7-hexyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)stannane (PubChem CID 11071330) has the molecular formula C24H44O2SSn and a molecular weight of 515.39 g/mol. Its IUPAC name is tributyl-(7-hexyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)stannane.
| Compound Name | tributyl-(7-hexyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)stannane |
|---|---|
| PubChem CID | 11071330 |
| Molecular Formula | C24H44O2SSn |
| Molecular Weight | 515.39 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | tributyl-(7-hexyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)stannane |
| SMILES | CCCCCCc1sc([Sn](CCCC)(CCCC)CCCC)c2c1OCCO2 |
| InChI | InChI=1S/C12H17O2S.3C4H9.Sn/c1-2-3-4-5-6-11-12-10(9-15-11)13-7-8-14-12;3*1-3-4-2;/h2-8H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | QYPSBNHYKUTTKH-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.39 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|