C12H18O2S — CID 11020600
5-hexyl-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 11020600) has the molecular formula C12H18O2S and a molecular weight of 226.34 g/mol. Its IUPAC name is 5-hexyl-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5-hexyl-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 11020600 |
| Molecular Formula | C12H18O2S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 5-hexyl-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | CCCCCCc1scc2c1OCCO2 |
| InChI | InChI=1S/C12H18O2S/c1-2-3-4-5-6-11-12-10(9-15-11)13-7-8-14-12/h9H,2-8H2,1H3 |
| InChIKey | QIWLEULVJYJBFW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|