C10H8O2S2 — CID 15488041
5-thiophen-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 15488041) has the molecular formula C10H8O2S2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 5-thiophen-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5-thiophen-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 15488041 |
| Molecular Formula | C10H8O2S2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.00 |
| IUPAC Name | 5-thiophen-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | c1csc(-c2scc3c2OCCO3)c1 |
| InChI | InChI=1S/C10H8O2S2/c1-2-8(13-5-1)10-9-7(6-14-10)11-3-4-12-9/h1-2,5-6H,3-4H2 |
| InChIKey | NYZAOHBPTKJUBI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |